| Name |
Triacontanoic acid Melissic acid |
| Formula |
C30H60O2 |
| Mw |
452.45933116 |
| CAS RN |
506-50-3 |
| C_ID |
C00051531
|
| InChIKey |
HZLSVLHNDMOZNA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H60O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30(31)32/h2-29H2,1H3,(H,31,32) |
| SMILES |
CCCCCCCCCCCCCCCCCCCCCCCCCCCCCOC=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anthericaceae | Chlorophytum arundinaceum  | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
| Plantae | Myrsinaceae | Embelia parviflora | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Chlorophytum arundinaceum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|