| Name |
Matsutake alcohol |
| Formula |
C8H16O |
| Mw |
128.12011513 |
| CAS RN |
3687-48-7 |
| C_ID |
C00051508
|
| InChIKey |
VSMOENVRRABVKN-SVGMAFHSNA-N |
| InChICode |
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/t8-/m0/s1 |
| SMILES |
C=C[C@H](O)CCCCC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Agaricaceae | Agaricus bisporus  | Ref. |
| Fungi | Polyporaceae | Lentinus edodes | Ref. |
| Fungi | Tricholomataceae | Tricholoma matsutake | Ref. |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Laminariaceae | Laminaria japonica | Ref. |
|
|
zoom in
| Organism | Agaricus bisporus |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Kajawara, et al., J Food Science, 53, (1985), 960.
Chen, et al., ACS Symp Ser, 317, (1986), 176.
Takeshi, et al., Chem Abstr, 106, (1987), 27806m.
Suire, et al., Phytochemistry, 21, (1982), 349 |
|---|
|
