| Name |
Magnosprengerine |
| Formula |
C11H17NO2 |
| Mw |
195.12592879 |
| CAS RN |
35266-63-8 |
| C_ID |
C00051436
|
| InChIKey |
SQKKYSLRUHVTFX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H17NO2/c1-12(2)7-6-9-4-5-10(13)11(8-9)14-3/h4-5,8,13H,6-7H2,1-3H3 |
| SMILES |
COc1cc(CCN(C)C)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Magnoliaceae | Magnolia sprengeri  | Ref. |
|
|
zoom in
| Organism | Magnolia sprengeri |
|---|
| Reference | Zhang, China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 14, (1998), 53.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
