| Name |
Magnolignan F |
| Formula |
C36H36O6 |
| Mw |
564.25118888 |
| CAS RN |
138591-10-3 |
| C_ID |
C00051431
|
| InChIKey |
FVWZTCBBMRXVFJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C36H36O6/c1-4-7-23-10-14-31(37)27(18-23)29-21-26(13-16-33(29)39)36(41)34(40)22-42-35-17-12-25(9-6-3)20-30(35)28-19-24(8-5-2)11-15-32(28)38/h4-6,10-21,34,36-41H,1-3,7-9,22H2 |
| SMILES |
C=CCc1ccc(O)c(-c2cc(C(O)C(O)COc3ccc(CC=C)cc3-c3cc(CC=C)ccc3O)ccc2O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
|
|
zoom in
| Organism | Magnolia officinalis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|