| Name |
Magnolignan E |
| Formula |
C18H18O4 |
| Mw |
298.12050906 |
| CAS RN |
138591-08-9 |
| C_ID |
C00051430
|
| InChIKey |
BDPOAFGMWRJXAL-ZVOYONDMNA-N |
| InChICode |
InChI=1/C18H18O4/c1-2-3-11-4-6-15(20)13(8-11)12-5-7-16-14(9-12)18(21)17(10-19)22-16/h2,4-9,17-21H,1,3,10H2/t17-,18+/s2 |
| SMILES |
C=CCc1ccc(O)c(-c2ccc3c(c2)[C@H](O)[C@@H](CO)O3)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
|
|
zoom in
| Organism | Magnolia officinalis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
