| Name |
Lygodinolide |
| Formula |
C27H36O4 |
| Mw |
424.26135964 |
| CAS RN |
127793-92-4 |
| C_ID |
C00051366
|
| InChIKey |
ABBZZTOIFXCLFD-UVOMHKQNNA-N |
| InChICode |
InChI=1S/C27H36O4/c1-15-8-9-20-25(6)12-11-21(28)24(4,5)19(25)10-13-26(20,7)27(15)14-18-22(31-27)16(2)17(3)30-23(18)29/h19-20H,1,8-14H2,2-7H3/t19-,20+,25-,26+,27-/m0/s1 |
| SMILES |
C=C1CC[C@@H]2[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@@]2(C)[C@]12Cc1c(c(C)c(C)oc1=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum  | Ref. |
|
|
zoom in
| Organism | Lygodium flexuosum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|