| Name |
Lycernuic acid B |
| Formula |
C30H48O5 |
| Mw |
488.35017464 |
| CAS RN |
53755-78-5 |
| C_ID |
C00051355
|
| InChIKey |
VNVCUEDCOPDGDF-LMYFCGCUNA-N |
| InChICode |
InChI=1S/C30H48O5/c1-26-13-10-22-28(3,15-12-24(33)30(22,5)25(34)35)20(26)9-7-19-18(16-26)6-8-21-27(19,2)14-11-23(32)29(21,4)17-31/h6,19-24,31-33H,7-17H2,1-5H3,(H,34,35)/t19-,20-,21+,22+,23+,24-,26-,27+,28+,29+,30+/m0/s1 |
| SMILES |
C[C@@]12CC[C@@H]3[C@](C)(CC[C@H](O)[C@]3(C)OC=O)[C@H]1CC[C@H]1C(=CC[C@@H]3[C@]1(C)CC[C@@H](O)[C@]3(C)CO)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Lycopodium cernuum  | Ref. |
|
|
zoom in
| Organism | Lycopodium cernuum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Zhang, et al., Journal of Natural Products, 65, (2002), 979 |
|---|
|