| Name |
Lophanthoidin D |
| Formula |
C22H32O6 |
| Mw |
392.21988875 |
| CAS RN |
120462-44-4 |
| C_ID |
C00051325
|
| InChIKey |
RKFLDMZOLRTDIZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C22H32O6/c1-6-28-19-13-14(17(26)16(25)12(15(13)24)11(2)10-23)22(5)9-7-8-21(3,4)20(22)18(19)27/h11,18-20,23,25,27H,6-10H2,1-5H3 |
| SMILES |
CCOC1C2=C(C(=O)C(O)=C(C(C)CO)C2=O)C2(C)CCCC(C)(C)C2C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Isodon lophanthoides | Ref. |
|
|
zoom in
| Organism | Isodon lophanthoides | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sun, et al., Diterpenoids from Isodon Species, Science Press, Beijing, (2001) |
|---|
|