| Name |
Lophanthoidin B |
| Formula |
C24H32O8 |
| Mw |
448.209718 |
| CAS RN |
120462-42-2 |
| C_ID |
C00051323
|
| InChIKey |
OQMXWVLDSYRANX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C24H32O8/c1-11(10-31-12(2)25)14-17(27)15-16(19(29)18(14)28)24(6)9-7-8-23(4,5)22(24)20(30)21(15)32-13(3)26/h11,20-22,28,30H,7-10H2,1-6H3 |
| SMILES |
CC(=O)OCC(C)C1=C(O)C(=O)C2=C(C1=O)C(OC(C)=O)C(O)C1C(C)(C)CCCC21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Isodon lophanthoides | Ref. |
|
|
zoom in
| Organism | Isodon lophanthoides | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sun, et al., Diterpenoids from Isodon Species, Science Press, Beijing, (2001) |
|---|
|