| Name |
Longilene peroxide |
| Formula |
C30H52O8 |
| Mw |
540.36621864 |
| CAS RN |
139742-08-8 |
| C_ID |
C00051309
|
| InChIKey |
QLFRXAKUUDRERJ-PHYSXVDHNA-N |
| InChICode |
InChI=1S/C30H52O8/c1-25(2,31)15-9-17-27(5,32)21-13-19-29(7,36-21)23-11-12-24(35-23)30(8)20-14-22(37-30)28(6,33)18-10-16-26(3,4)38-34/h9-10,15-16,21-24,31-34H,11-14,17-20H2,1-8H3/b15-9+,16-10+/t21-,22-,23-,24-,27+,28+,29+,30+/m1/s1 |
| SMILES |
CC(C)(O)/C=C/C[C@](C)(O)[C@H]1CC[C@@](C)([C@H]2CC[C@H]([C@]3(C)CC[C@H]([C@@](C)(O)C/C=C/C(C)(C)OO)O3)O2)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Simaroubaceae | Eurycoma longifolia  | Ref. |
|
|
zoom in
| Organism | Eurycoma longifolia | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Guo, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 16, (2005), 88 |
|---|
|