| Name |
Lochneridine (+)-Lochneridine |
| Formula |
C20H24N2O3 |
| Mw |
340.17869265 |
| CAS RN |
5980-01-8 |
| C_ID |
C00051307
|
| InChIKey |
DGKIJZKKTDPACC-DCMZKIDVNA-N |
| InChICode |
InChI=1S/C20H24N2O3/c1-3-19(24)11-22-9-8-20-12-6-4-5-7-14(12)21-17(20)16(18(23)25-2)13(19)10-15(20)22/h4-7,13,15,21,24H,3,8-11H2,1-2H3/t13-,15+,19-,20-/m1/s1 |
| SMILES |
CC[C@@]1(O)CN2CC[C@]34C(=C(C(=O)OC)[C@H]1C[C@H]23)Nc1ccccc14 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|