| Name |
Liwaconitine |
| Formula |
C41H53NO11 |
| Mw |
735.36186154 |
| CAS RN |
86408-15-3 |
| C_ID |
C00051303
|
| InChIKey |
RYCIRRXOFHVZHA-QWNVIMGDNA-N |
| InChICode |
InChI=1S/C41H53NO11/c1-8-42-21-38(22-46-2)18-17-28(49-5)41-27-19-39(45)29(50-6)20-40(31(34(41)42)32(51-7)33(38)41,53-37(44)24-11-15-26(48-4)16-12-24)30(27)35(39)52-36(43)23-9-13-25(47-3)14-10-23/h9-16,27-35,45H,8,17-22H2,1-7H3/t27-,28+,29+,30-,31+,32+,33-,34-,35-,38+,39+,40-,41+/m1/s1 |
| SMILES |
CCN1C[C@]2(COC)CC[C@H](OC)C34C1C([C@H](OC)[C@@H]32)[C@@]1(OC(=O)c2ccc(OC)cc2)C[C@H](OC)[C@@]2(O)C[C@@H]4[C@@H]1[C@H]2OC(=O)c1ccc(OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum forrrestii | Ref. |
|
|
zoom in
| Organism | Aconitum forrrestii |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
