| Name |
Lithocholic acid |
| Formula |
C24H40O3 |
| Mw |
376.29774514 |
| CAS RN |
434-13-9 |
| C_ID |
C00051298
|
| InChIKey |
IXJSUZXJRUAOFB-HFDLPBCYNA-N |
| InChICode |
InChI=1S/C24H40O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16-,17-,18+,19-,20+,21+,23+,24-/m1/s1 |
| SMILES |
C[C@H](CCOC=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bovidae | Bos taurus domesticus  | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
|
|
zoom in
| Organism | Bos taurus domesticus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|