| Name |
Liqcoumarin |
| Formula |
C12H10O4 |
| Mw |
218.05790881 |
| CAS RN |
36695-19-9 |
| C_ID |
C00051290
|
| InChIKey |
UMNMVZFOKSPTJN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H10O4/c1-6-5-10(14)16-9-4-3-8(7(2)13)12(15)11(6)9/h3-5,15H,1-2H3 |
| SMILES |
CC(=O)c1ccc2oc(=O)cc(C)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
