| Name |
Ligustrosidic acid |
| Formula |
C25H30O14 |
| Mw |
554.16355567 |
| CAS RN |
96382-89-7 |
| C_ID |
C00051276
|
| InChIKey |
FDSOOQDBXYPUJW-YVLHZVERNA-N |
| InChICode |
InChI=1S/C25H30O14/c1-35-23(34)16-11-37-24(39-25-22(33)21(32)20(31)17(10-26)38-25)15(8-18(28)29)14(16)9-19(30)36-7-6-12-2-4-13(27)5-3-12/h2-5,8,11,14,17,20-22,24-27,31-33H,6-7,9-10H2,1H3,(H,28,29) |
| SMILES |
COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)/C(=COC=O)C1CC(=O)OCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Ligustrum lucidum  | Ref. |
|
|
zoom in
| Organism | Ligustrum lucidum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
