| Name |
Lienkonine |
| Formula |
C21H25NO4 |
| Mw |
355.17835829 |
| CAS RN |
83151-88-6 |
| C_ID |
C00051271
|
| InChIKey |
OFHYKBHNENOGPU-ZEFNCDPZNA-N |
| InChICode |
InChI=1S/C21H25NO4/c1-12-20-14(5-6-17(24-2)21(20)23)9-16-15-11-19(26-4)18(25-3)10-13(15)7-8-22(12)16/h5-6,10-12,16,23H,7-9H2,1-4H3/t12-,16+/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)[C@@H]1Cc3ccc(OC)c(O)c3[C@@H](C)N1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ochotensis | Ref. |
|
|
zoom in
| Organism | Corydalis ochotensis |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
