| Name |
Liconosine A |
| Formula |
C20H29NO4 |
| Mw |
347.20965842 |
| CAS RN |
126621-43-0 |
| C_ID |
C00051260
|
| InChIKey |
QUROZHQXUZXTRR-HWHYCMOINA-N |
| InChICode |
InChI=1S/C20H29NO4/c1-24-14-7-19(23)13-6-11-9-3-4-15(25-2)20(11,18(13)21-8-9)12-5-10(14)17(22)16(12)19/h8-18,22-23H,3-7H2,1-2H3/t9-,10+,11+,12+,13-,14-,15-,16+,17-,18+,19-,20-/m0/s1 |
| SMILES |
CO[C@H]1C[C@]2(O)C3C[C@@H]4[C@@H]5C=NC3C4([C@@H](OC)CC5)[C@@H]3C[C@H]1[C@H](O)[C@@H]32 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum forrrestii | Ref. |
|
|
zoom in
| Organism | Aconitum forrrestii | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|