| Name |
Ledeboridine |
| Formula |
C20H21NO6 |
| Mw |
371.13688741 |
| CAS RN |
64191-01-1 |
| C_ID |
C00051224
|
| InChIKey |
QORTZZDWGWYNFK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H21NO6/c1-21-6-5-10-7-15(25-2)13(22)8-12(10)20(21)18(23)11-3-4-14-17(27-9-26-14)16(11)19(20)24/h3-4,7-8,18-19,22-24H,5-6,9H2,1-2H3 |
| SMILES |
COc1cc2c(cc1O)C1(C(O)c3ccc4c(c3C1O)OCO4)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
|
|
zoom in
| Organism | Corydalis ledebouriana |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
