| Name |
Laxogenin |
| Formula |
C27H42O4 |
| Mw |
430.30830983 |
| CAS RN |
1177-71-5 |
| C_ID |
C00051222
|
| InChIKey |
WOJKRRDDERNLBU-LIDGHWLENA-N |
| InChICode |
InChI=1S/C27H42O4/c1-15-5-10-27(30-14-15)16(2)24-23(31-27)13-20-18-12-22(29)21-11-17(28)6-8-25(21,3)19(18)7-9-26(20,24)4/h15-21,23-24,28H,5-14H2,1-4H3/t15-,16+,17+,18-,19+,20+,21-,23+,24+,25-,26+,27-/m1/s1 |
| SMILES |
C[C@@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC(=O)[C@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium chinense  | Ref. |
| Plantae | Smilacaceae | Smilax sieboldii | Ref. |
|
|
zoom in
| Organism | Allium chinense | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 276 |
|---|
|