| Name |
Lappaol E |
| Formula |
C30H34O10 |
| Mw |
554.21519731 |
| CAS RN |
64855-02-3 |
| C_ID |
C00051204
|
| InChIKey |
ASYBYLYCBSRGRZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C30H34O10/c1-36-25-12-18(4-7-22(25)32)11-21-20(16-39-30(21)35)10-17-5-9-24(27(13-17)38-3)40-28(15-31)29(34)19-6-8-23(33)26(14-19)37-2/h4-9,12-14,20-21,28-29,31-34H,10-11,15-16H2,1-3H3 |
| SMILES |
COc1cc(CC2C(=O)OCC2Cc2ccc(OC(CO)C(O)c3ccc(O)c(OC)c3)c(OC)c2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arctium lappa  | Ref. |
|
|
zoom in
| Organism | Arctium lappa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|