| Name |
Lappaol B |
| Formula |
C31H34O9 |
| Mw |
550.22028269 |
| CAS RN |
62359-60-8 |
| C_ID |
C00051203
|
| InChIKey |
KNSPNZVXPUCWMJ-LRVAALOONA-N |
| InChICode |
InChI=1S/C31H34O9/c1-35-25-8-5-17(12-27(25)37-3)9-20-16-39-31(34)21(20)10-18-11-22-23(15-32)29(40-30(22)28(13-18)38-4)19-6-7-24(33)26(14-19)36-2/h5-8,11-14,20-21,23,29,32-33H,9-10,15-16H2,1-4H3/t20-,21+,23-,29+/m0/s1 |
| SMILES |
COc1cc([C@H]2Oc3c(OC)cc(C[C@H]4C(=O)OC[C@@H]4Cc4ccc(OC)c(OC)c4)cc3[C@@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arctium lappa  | Ref. |
|
|
zoom in
| Organism | Arctium lappa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|