| Name |
Lactarol |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
52618-16-3 |
| C_ID |
C00051188
|
| InChIKey |
HKHFXLOHBNXUKB-LDGXTIHJNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-11(12-4-5-15(2,3)7-12)6-13-9-17-10-14(13)8-16/h4,9-11,16H,5-8H2,1-3H3/t11-/m1/s1 |
| SMILES |
C[C@H](Cc1cocc1CO)C1=CCC(C)(C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Russulaceae | Lactarius vellereus  | Ref. |
|
|
zoom in
| Organism | Lactarius vellereus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|