| Name |
Laccaic acid D |
| Formula |
C16H10O7 |
| Mw |
314.04265268 |
| CAS RN |
18499-84-8 |
| C_ID |
C00051186
|
| InChIKey |
ODASXODZYSHSDM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H10O7/c1-5-11-8(4-10(19)12(5)16(22)23)14(20)7-2-6(17)3-9(18)13(7)15(11)21/h2-4,17-19H,1H3,(H,22,23) |
| SMILES |
Cc1c(OC=O)c(O)cc2c1C(=O)c1c(O)cc(O)cc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus verniciflua  | Ref. |
|
|
zoom in
| Organism | Rhus verniciflua |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
