| Name |
Laccaic acid C |
| Formula |
C25H17NO13 |
| Mw |
539.06998964 |
| CAS RN |
23241-56-7 |
| C_ID |
C00051185
|
| InChIKey |
ZNTCIYHBLMXNND-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H17NO13/c26-9(23(34)35)4-6-1-2-10(27)7(3-6)13-20(31)17-16(22(33)21(13)32)18(29)8-5-11(28)14(24(36)37)15(25(38)39)12(8)19(17)30/h1-3,5,9,27-28,31-33H,4,26H2,(H,34,35)(H,36,37)(H,38,39) |
| SMILES |
NC(Cc1ccc(O)c(-c2c(O)c(O)c3c(c2O)C(=O)c2c(cc(O)c(OC=O)c2OC=O)C3=O)c1)OC=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus verniciflua  | Ref. |
|
|
zoom in
| Organism | Rhus verniciflua | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|