| Name |
Laccaic acid B |
| Formula |
C24H16O12 |
| Mw |
496.06417598 |
| CAS RN |
17249-00-2 |
| C_ID |
C00051184
|
| InChIKey |
HDMNSZWAADCTJX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H16O12/c25-4-3-7-1-2-10(26)8(5-7)13-20(30)17-16(22(32)21(13)31)18(28)9-6-11(27)14(23(33)34)15(24(35)36)12(9)19(17)29/h1-2,5-6,25-27,30-32H,3-4H2,(H,33,34)(H,35,36) |
| SMILES |
O=COc1c(O)cc2c(c1OC=O)C(=O)c1c(O)c(-c3cc(CCO)ccc3O)c(O)c(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus verniciflua  | Ref. |
|
|
zoom in
| Organism | Rhus verniciflua |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
