| Name |
Laccaic acid A |
| Formula |
C26H19NO12 |
| Mw |
537.09072508 |
| CAS RN |
15979-35-8 |
| C_ID |
C00051183
|
| InChIKey |
UWZXEVJRMHFJJS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C26H19NO12/c1-8(28)27-5-4-9-2-3-12(29)10(6-9)15-22(33)19-18(24(35)23(15)34)20(31)11-7-13(30)16(25(36)37)17(26(38)39)14(11)21(19)32/h2-3,6-7,29-30,33-35H,4-5H2,1H3,(H,27,28)(H,36,37)(H,38,39) |
| SMILES |
CC(=O)NCCc1ccc(O)c(-c2c(O)c(O)c3c(c2O)C(=O)c2c(cc(O)c(OC=O)c2OC=O)C3=O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus verniciflua  | Ref. |
| - | - | Laccifer lacca  | Ref. |
|
|
zoom in
| Organism | Rhus verniciflua | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|