| Name |
Kuzusapogenol A Kudzusapogenol A |
| Formula |
C30H50O5 |
| Mw |
490.36582471 |
| CAS RN |
96820-46-1 |
| C_ID |
C00051163
|
| InChIKey |
IDTOPFLVXUKSME-AZHDWDLHNA-N |
| InChICode |
InChI=1S/C30H50O5/c1-25(16-31)15-19-18-7-8-21-27(3)11-10-22(33)28(4,17-32)20(27)9-12-30(21,6)29(18,5)14-13-26(19,2)24(35)23(25)34/h7,19-24,31-35H,8-17H2,1-6H3/t19-,20+,21+,22-,23-,24+,25+,26+,27-,28+,29+,30+/m0/s1 |
| SMILES |
CC1(C)[C@@H](O[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)CC[C@]2(C)[C@H]3C=CC4=C5[C@]6(CC[C@](C)(OC6=O)[C@@]5(C)O)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Abrus fruticulosus | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
|
|
zoom in
| Organism | Abrus fruticulosus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|