| Name |
Karounidiol |
| Formula |
C30H48O2 |
| Mw |
440.36543078 |
| CAS RN |
118117-31-0 |
| C_ID |
C00051132
|
| InChIKey |
UIXJVDGAGQPTFR-PRIXTKBONA-N |
| InChICode |
InChI=1S/C30H48O2/c1-25(2)22-9-8-21-20(28(22,5)12-11-24(25)32)10-13-30(7)23-18-26(3,19-31)14-15-27(23,4)16-17-29(21,30)6/h8,10,22-24,31-32H,9,11-19H2,1-7H3/t22-,23+,24+,26+,27+,28+,29+,30-/m0/s1 |
| SMILES |
CC1(C)[C@H](O)CC[C@]2(C)C3=CC[C@@]4(C)[C@@H]5C[C@](C)(CO)CC[C@]5(C)CC[C@]4(C)C3=CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Trichosanthes korilowii | Ref. |
|
|
zoom in
| Organism | Trichosanthes korilowii |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Yasukawa, et al., Biol Pharm Bull, 17, (1994), 460.
Akihisa, et al., Chem Pharm Bull, 40, (1992), 1199.
Akihisa, et al., J Chem Soc, Perkin Trans I, (1988), 439 |
|---|
|
