| Name |
Kapurol |
| Formula |
C30H52O3 |
| Mw |
460.39164553 |
| CAS RN |
19865-92-0 |
| C_ID |
C00051128
|
| InChIKey |
RQBNSDSKUAGBOI-ZHWGBPGYNA-N |
| InChICode |
InChI=1S/C30H52O3/c1-25(2)21-12-17-29(7)22(27(21,5)15-13-23(25)31)10-9-19-20(11-16-28(19,29)6)30(8)18-14-24(33-30)26(3,4)32/h19-24,31-32H,9-18H2,1-8H3/t19-,20+,21+,22-,23+,24?,27+,28-,29-,30-/m1/s1 |
| SMILES |
CC(C)(O)C1CC[C@](C)([C@H]2CC[C@]3(C)[C@@H]2CC[C@@H]2[C@@]4(C)CC[C@H](O)C(C)(C)[C@@H]4CC[C@]23C)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dipterocarpaceae | Dryobalanops aromatica  | Ref. |
|
|
zoom in
| Organism | Dryobalanops aromatica | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|