| Name |
Kadsulignan B |
| Formula |
C25H30O9 |
| Mw |
474.18898256 |
| CAS RN |
122350-75-8 |
| C_ID |
C00051103
|
| InChIKey |
OHOKZEXDBOSOBF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H30O9/c1-11-12(2)20(33-13(3)26)15-10-16(27)21(29-5)24(32-8)25(15)18-14(19(11)34-25)9-17(28-4)22(30-6)23(18)31-7/h9-12,19-20H,1-8H3 |
| SMILES |
COC1=C(OC)C23OC(c4cc(OC)c(OC)c(OC)c42)C(C)C(C)C(OC(C)=O)C3=CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Schisandraceae | Kadsura coccinea | Ref. |
|
|
zoom in
| Organism | Kadsura coccinea |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 1120 |
|---|
|
