| Name |
Kadsulactone |
| Formula |
C30H44O3 |
| Mw |
452.32904527 |
| CAS RN |
137348-13-1 |
| C_ID |
C00051099
|
| InChIKey |
VBYGVAYPZKNUEG-LZEOEFJANA-N |
| InChICode |
InChI=1S/C30H44O3/c1-18-7-8-21(33-25(18)32)19(2)20-11-13-28(6)23-10-9-22-26(3,4)24(31)12-14-29(22)17-30(23,29)16-15-27(20,28)5/h7,19-23H,8-17H2,1-6H3/t19-,20+,21+,22-,23-,27+,28-,29+,30-/m0/s1 |
| SMILES |
CC1=CC[C@H]([C@@H](C)[C@H]2CC[C@@]3(C)[C@@H]4CC[C@H]5C(C)(C)C(=O)CC[C@@]56C[C@@]46CC[C@]23C)OC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Schisandraceae | Kadsura coccinea | Ref. |
| Plantae | Schisandraceae | Kadsura peltigera | Ref. |
|
|
zoom in
| Organism | Kadsura coccinea |
|---|
| Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Li, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 1120.
Zhou, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 38, (2003), 81 |
|---|
|
