| Name |
Jionoside C |
| Formula |
C29H36O13 |
| Mw |
592.21559124 |
| CAS RN |
120406-33-9 |
| C_ID |
C00051040
|
| InChIKey |
UKRDIRUVTNZWOU-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C29H36O13/c1-15-22(34)23(35)24(36)29(39-15)42-27-25(37)28(38-12-11-16-5-3-2-4-6-16)40-20(14-30)26(27)41-21(33)10-8-17-7-9-18(31)19(32)13-17/h2-10,13,15,20,22-32,34-37H,11-12,14H2,1H3 |
| SMILES |
CC1OC(OC2C(O)C(OCCc3ccccc3)OC(CO)C2OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Rehmannia glutinosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|