| Name |
Jatropham |
| Formula |
C5H7NO2 |
| Mw |
113.04767848 |
| CAS RN |
50656-76-3 |
| C_ID |
C00051027
|
| InChIKey |
DORDKUBCRPNETF-SGAVLPGINA-N |
| InChICode |
InChI=1S/C5H7NO2/c1-3-2-4(7)6-5(3)8/h2,4,7H,1H3,(H,6,8)/t4-/m1/s1 |
| SMILES |
CC1=C[C@@H](O)NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Jatropha curcas  | Ref. |
| Plantae | Liliaceae | Lilium hansonii | Ref. |
|
|
zoom in
| Organism | Jatropha curcas | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|