| Name |
Japonicin D |
| Formula |
C36H44O12 |
| Mw |
668.28327687 |
| CAS RN |
115538-77-7 |
| C_ID |
C00051024
|
| InChIKey |
IGABZFRXHFBVJP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C36H44O12/c1-13(2)23(37)20-27(41)16(11-18-29(43)21(24(38)14(3)4)33(47)35(7,8)31(18)45)26(40)17(28(20)42)12-19-30(44)22(25(39)15(5)6)34(48)36(9,10)32(19)46/h13-15,40-42,45-48H,11-12H2,1-10H3 |
| SMILES |
CC(C)C(=O)C1=C(O)C(C)(C)C(O)=C(Cc2c(O)c(CC3=C(O)C(C)(C)C(O)=C(C(=O)C(C)C)C3=O)c(O)c(C(=O)C(C)C)c2O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
|
|
zoom in
| Organism | Hypericum japonicum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|