| Name |
Japonicin B |
| Formula |
C33H42O8 |
| Mw |
566.28796832 |
| CAS RN |
115589-77-0 |
| C_ID |
C00051023
|
| InChIKey |
SYFIXLCCYKCHDT-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C33H42O8/c1-16(2)11-10-13-33(9)14-12-19-26(36)20(27(37)22(29(19)41-33)24(34)17(3)4)15-21-28(38)23(25(35)18(5)6)31(40)32(7,8)30(21)39/h11-12,14,17-18,36-37,39-40H,10,13,15H2,1-9H3 |
| SMILES |
CC(C)=CCCC1(C)C=Cc2c(O)c(CC3=C(O)C(C)(C)C(O)=C(C(=O)C(C)C)C3=O)c(O)c(C(=O)C(C)C)c2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
|
|
zoom in
| Organism | Hypericum japonicum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|