| Name |
Isotoralactone |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
80503-54-4 |
| C_ID |
C00051009
|
| InChIKey |
GEZBDPPVXYFNMG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H12O5/c1-7-3-8-4-9-5-10(19-2)6-11(16)12(9)14(17)13(8)15(18)20-7/h4-6,16-17H,1,3H2,2H3 |
| SMILES |
C=C1Cc2cc3cc(OC)cc(O)c3c(O)c2C(=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cassia obtusifolia  | Ref. |
|
|
zoom in
| Organism | Cassia obtusifolia | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|