| Name |
Isotoosendanin |
| Formula |
C30H38O11 |
| Mw |
574.24141206 |
| CAS RN |
97871-44-8 |
| C_ID |
C00051008
|
| InChIKey |
GEHGAWHOBGXBGC-SMTROHKMNA-N |
| InChICode |
InChI=1S/C30H38O11/c1-13(31)40-21-10-20(35)30-12-39-26(37)28(21,4)18(30)9-19(34)29(5)23-17(33)8-16(15-6-7-38-11-15)27(23,3)25(41-14(2)32)22(36)24(29)30/h6-7,11,16,18-21,23-26,34-35,37H,8-10,12H2,1-5H3/t16-,18-,19+,20-,21+,23+,24-,25-,26?,27-,28+,29-,30+/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1C[C@H](O)[C@@]23COC(O)C1(C)[C@@H]2C[C@@H](O)[C@]1(C)C3C(=O)[C@H](OC(C)=O)[C@@]2(C)[C@H](c3ccoc3)CC(=O)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Meliaceae | Melia toosendan  | Ref. |
|
|
zoom in
| Organism | Melia toosendan |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
