| Name |
Isostrychnine N-oxide |
| Formula |
C21H22N2O3 |
| Mw |
350.16304258 |
| CAS RN |
130641-44-0 |
| C_ID |
C00051000
|
| InChIKey |
JSOOHERMGHRAQI-NTUHNPAUNA-N |
| InChICode |
InChI=1S/C21H22N2O3/c24-10-7-13-12-23(26)9-8-21-16-3-1-2-4-17(16)22-19(25)6-5-14(20(21)22)15(13)11-18(21)23/h1-5,7,15,18,20,24H,6,8-12H2 |
| SMILES |
O=C1CC=C2C3CC4C5(CC[N+]4([O-])C/C3=CCO)c3ccccc3N1C25 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
|
|
zoom in
| Organism | Strychnos nux-vomica | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Cai, et al., J of Natural Medicines(Japan), 44, (1990), 42.
Cai, et al., J of Natural Medicines(Japan), 49, (1995), 39 |
|---|
|