| Name |
Isostrychnine |
| Formula |
C21H22N2O2 |
| Mw |
334.16812796 |
| CAS RN |
467-16-3 |
| C_ID |
C00050999
|
| InChIKey |
PNYOGGAOQVIZDM-XHGHAPFCNA-N |
| InChICode |
InChI=1S/C21H22N2O2/c24-10-7-13-12-22-9-8-21-16-3-1-2-4-17(16)23-19(25)6-5-14(20(21)23)15(13)11-18(21)22/h1-5,7,15,18,20,24H,6,8-12H2/b13-7-/t15-,18-,20-,21+/m0/s1 |
| SMILES |
O=C1CC=C2[C@H]3C[C@@H]4N(CC[C@@]45c4ccccc4N1[C@@H]25)C/C3=C/CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
|
|
zoom in
| Organism | Strychnos nux-vomica | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Yang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 18, (1993), 739 |
|---|
|