| Name |
Isoschizandrin |
| Formula |
C24H32O7 |
| Mw |
432.21480338 |
| CAS RN |
114422-18-3 |
| C_ID |
C00050997
|
| InChIKey |
YEFOAORQXAOVJQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C24H32O7/c1-13-9-14-10-16(26-3)20(28-5)22(30-7)18(14)19-15(12-24(13,2)25)11-17(27-4)21(29-6)23(19)31-8/h10-11,13,25H,9,12H2,1-8H3 |
| SMILES |
COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OC)c1OC)CC(C)(O)C(C)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
|
|
zoom in
| Organism | Schisandra chinensis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
