| Name |
Isorutarin |
| Formula |
C20H24O10 |
| Mw |
424.13694699 |
| CAS RN |
53846-51-8 |
| C_ID |
C00050995
|
| InChIKey |
QZUDEXAHKXCIDG-CNDFQIOUNA-N |
| InChICode |
InChI=1S/C20H24O10/c1-20(2,30-19-15(25)14(24)13(23)10(7-21)27-19)11-6-9-5-8-3-4-12(22)29-17(8)16(26)18(9)28-11/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3/t10-,11-,13-,14+,15-,19+/m1/s1 |
| SMILES |
CC(C)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H]1Cc2cc3ccc(=O)oc3c(O)c2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
|
|
zoom in
| Organism | Peucedanum praeruptorum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|