| Name |
Isoponcimarin |
| Formula |
C19H22O5 |
| Mw |
330.14672381 |
| CAS RN |
59176-65-7 |
| C_ID |
C00050981
|
| InChIKey |
GQNWYSYOSQOHAT-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H22O5/c1-11(2)14(20)9-13-15(22-10-16-19(3,4)24-16)7-5-12-6-8-17(21)23-18(12)13/h5-8,11,16H,9-10H2,1-4H3 |
| SMILES |
CC(C)C(=O)Cc1c(OCC2OC2(C)C)ccc2ccc(=O)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
|
|
zoom in
| Organism | Poncirus trifoliata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|