| Name |
Isopaeonol |
| Formula |
C9H10O3 |
| Mw |
166.06299419 |
| CAS RN |
493-33-4 |
| C_ID |
C00050975
|
| InChIKey |
XPHIPEXPAGCEBM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O3/c1-6(10)8-4-3-7(11)5-9(8)12-2/h3-5,11H,1-2H3 |
| SMILES |
COc1cc(O)ccc1C(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Cynanchum paniculatum | Ref. |
|
|
zoom in
| Organism | Cynanchum paniculatum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
