| Name |
Isoophiopogonone A |
| Formula |
C18H14O6 |
| Mw |
326.07903818 |
| CAS RN |
75239-61-1 |
| C_ID |
C00050974
|
| InChIKey |
ODAXLBMOMQXICE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O6/c1-9-12(19)6-13(20)16-17(21)11(7-22-18(9)16)4-10-2-3-14-15(5-10)24-8-23-14/h2-3,5-7,19-20H,4,8H2,1H3 |
| SMILES |
Cc1c(O)cc(O)c2c(=O)c(Cc3ccc4c(c3)OCO4)coc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convallariaceae | Ophiopogon japonicus  | Ref. |
|
|
zoom in
| Organism | Ophiopogon japonicus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|