| Name |
Isoochotensine |
| Formula |
C21H21NO4 |
| Mw |
351.14705817 |
| CAS RN |
112642-44-1 |
| C_ID |
C00050970
|
| InChIKey |
JOCZITYCUXJNFR-RNZRUAGMNA-N |
| InChICode |
InChI=1S/C21H21NO4/c1-12-14-4-5-18-20(26-11-25-18)15(14)10-21(12)16-9-17(23)19(24-3)8-13(16)6-7-22(21)2/h4-5,8-9,23H,1,6-7,10-11H2,2-3H3/t21-/m0/s1 |
| SMILES |
C=C1c2ccc3c(c2C[C@@]12c1cc(O)c(OC)cc1CCN2C)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ochotensis | Ref. |
|
|
zoom in
| Organism | Corydalis ochotensis |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
