| Name |
Isoneonepetalactone |
| Formula |
C10H14O2 |
| Mw |
166.09937969 |
| CAS RN |
76549-18-3 |
| C_ID |
C00050964
|
| InChIKey |
BDXDSAWGUGHUQP-HGXVMFPFNA-N |
| InChICode |
InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h7-8H,3-5H2,1-2H3/t7-,8+/m0/s1 |
| SMILES |
CC1=C2C(=O)OC[C@H](C)[C@H]2CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| - | - | Actinida polygama | Ref. |
|
|
zoom in
| Organism | Actinida polygama |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
