| Name |
Isomurralonginol acetate |
| Formula |
C17H18O5 |
| Mw |
302.11542369 |
| CAS RN |
139115-59-6 |
| C_ID |
C00050960
|
| InChIKey |
KJRYZFDEVYMOEY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H18O5/c1-10(2)13(9-21-11(3)18)16-14(20-4)7-5-12-6-8-15(19)22-17(12)16/h5-8,13H,1,9H2,2-4H3 |
| SMILES |
C=C(C)C(COC(C)=O)c1c(OC)ccc2ccc(=O)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Murraya paniculata var.exotica  | Ref. |
|
|
zoom in
| Organism | Murraya paniculata var.exotica | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|