| Name |
Isolysergic acid
D-Isolysergic acid |
| Formula |
C16H16N2O2 |
| Mw |
268.12117777 |
| CAS RN |
478-95-5 |
| C_ID |
C00050951
|
| InChIKey |
ZAGRKAFMISFKIO-MOVNSBPVNA-N |
| InChICode |
InChI=1S/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)/t10-,14+/m0/s1 |
| SMILES |
CN1C[C@@H](C(=O)O)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Claviceps paspali | Ref. |
| Fungi | Clavicipitaceae | Claviceps purpurea  | Ref. |
|
|
zoom in
| Organism | Claviceps paspali |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
