| Name |
Isolobelanine |
| Formula |
C21H23NO2 |
| Mw |
321.17287899 |
| CAS RN |
6035-31-0 |
| C_ID |
C00050946
|
| InChIKey |
OMAMGHBETNHQJC-KDURUIRLNA-N |
| InChICode |
InChI=1/C21H23NO2/c23-20(16-8-3-1-4-9-16)14-18-12-7-13-19(22-18)15-21(24)17-10-5-2-6-11-17/h1-6,8-11,18-19,22H,7,12-15H2/t18-,19+ |
| SMILES |
O=C(C[C@H]1CCC[C@@H](CC(=O)c2ccccc2)N1)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia chinensis  | Ref. |
|
|
zoom in
| Organism | Lobelia chinensis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
