| Name |
Isolappaconitine |
| Formula |
C32H44N2O8 |
| Mw |
584.3097664 |
| CAS RN |
114216-94-3 |
| C_ID |
C00050942
|
| InChIKey |
YONAHJRVPWUFQS-INQDTSOKNA-N |
| InChICode |
InChI=1S/C32H44N2O8/c1-6-34-16-29(42-27(36)18-9-7-8-10-21(18)33-17(2)35)12-11-24(40-4)32-20-13-19-22(39-3)14-30(37,25(20)26(19)41-5)31(38,28(32)34)15-23(29)32/h7-10,19-20,22-26,28,37-38H,6,11-16H2,1-5H3,(H,33,35)/t19-,20-,22+,23-,24+,25-,26+,28-,29-,30-,31-,32-/m1/s1 |
| SMILES |
CCN1C[C@]2(OC(=O)c3ccccc3NOC)CC[C@H](OC)C34C1C(O)(C[C@@H]32)[C@@]1(O)C[C@H](OC)[C@H]2C[C@@H]4[C@@H]1[C@H]2OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum finetianum | Ref. |
|
|
zoom in
| Organism | Aconitum finetianum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
